C9H17NO3S — CID 117225725
3-(1,3-oxazolidin-2-ylmethyl)thiane 1,1-dioxide (PubChem CID 117225725) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 3-(1,3-oxazolidin-2-ylmethyl)thiane 1,1-dioxide.
| Compound Name | 3-(1,3-oxazolidin-2-ylmethyl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117225725 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 3-(1,3-oxazolidin-2-ylmethyl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC(CC2NCCO2)C1 |
| InChI | InChI=1S/C9H17NO3S/c11-14(12)5-1-2-8(7-14)6-9-10-3-4-13-9/h8-10H,1-7H2 |
| InChIKey | XFKTWEKWBSTUJB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |