C10H20N2O2 — CID 23447106
2-[4-(1,3-oxazolidin-2-yl)butyl]-1,3-oxazolidine (PubChem CID 23447106) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-[4-(1,3-oxazolidin-2-yl)butyl]-1,3-oxazolidine.
| Compound Name | 2-[4-(1,3-oxazolidin-2-yl)butyl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 23447106 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-[4-(1,3-oxazolidin-2-yl)butyl]-1,3-oxazolidine |
| SMILES | C(CCC1NCCO1)CC1NCCO1 |
| InChI | InChI=1S/C10H20N2O2/c1(3-9-11-5-7-13-9)2-4-10-12-6-8-14-10/h9-12H,1-8H2 |
| InChIKey | WZAJEPMSCLLEGP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|