C7H15NO3 — CID 141360794
1-[2-(1,3-oxazolidin-2-yl)ethoxy]ethanol (PubChem CID 141360794) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is 1-[2-(1,3-oxazolidin-2-yl)ethoxy]ethanol.
| Compound Name | 1-[2-(1,3-oxazolidin-2-yl)ethoxy]ethanol |
|---|---|
| PubChem CID | 141360794 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 1-[2-(1,3-oxazolidin-2-yl)ethoxy]ethanol |
| SMILES | CC(O)OCCC1NCCO1 |
| InChI | InChI=1S/C7H15NO3/c1-6(9)10-4-2-7-8-3-5-11-7/h6-9H,2-5H2,1H3 |
| InChIKey | HOQRLKRQLLFYRP-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|