About 3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide
3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide (PubChem CID 117227706) has the molecular formula C9H17NO3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is 3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide.
Analyze 3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide?
The IUPAC name of 3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide (CID 117227706) is 3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide.
What is the SMILES notation for 3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide?
The canonical SMILES for 3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide is CC1COC(CC2CCS(=O)(=O)C2)N1.
What is the InChIKey of 3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide?
The InChIKey is UYHDJFXSINIKDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3S/c1-7-5-13-9(10-7)4-8-2-3-14(11,12)6-8/h7-10H,2-6H2,1H3.
What are the key properties of 3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide?
3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide has a molecular weight of 219.31 g/mol, XLogP of 0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-1,3-oxazolidin-2-yl)methyl]thiolane 1,1-dioxide is sourced from PubChem (CID 117227706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).