About 4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide
4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide (PubChem CID 117228758) has the molecular formula C11H21NO3S
and a molecular weight of 247.36 g/mol. Its IUPAC name is 4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide.
Analyze 4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide?
The IUPAC name of 4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide (CID 117228758) is 4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide.
What is the SMILES notation for 4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide?
The canonical SMILES for 4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide is CC1(C)CNC(CC2CCS(=O)(=O)CC2)O1.
What is the InChIKey of 4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide?
The InChIKey is NMIRWWAJWHXMHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3S/c1-11(2)8-12-10(15-11)7-9-3-5-16(13,14)6-4-9/h9-10,12H,3-8H2,1-2H3.
What are the key properties of 4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide?
4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide has a molecular weight of 247.36 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,5-dimethyl-1,3-oxazolidin-2-yl)methyl]thiane 1,1-dioxide is sourced from PubChem (CID 117228758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).