C11H21NO3S — CID 117226211
4-(5,5-dimethyl-1,3-oxazinan-2-yl)thiane 1,1-dioxide (PubChem CID 117226211) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is 4-(5,5-dimethyl-1,3-oxazinan-2-yl)thiane 1,1-dioxide.
| Compound Name | 4-(5,5-dimethyl-1,3-oxazinan-2-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117226211 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-(5,5-dimethyl-1,3-oxazinan-2-yl)thiane 1,1-dioxide |
| SMILES | CC1(C)CNC(C2CCS(=O)(=O)CC2)OC1 |
| InChI | InChI=1S/C11H21NO3S/c1-11(2)7-12-10(15-8-11)9-3-5-16(13,14)6-4-9/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | DATVLYTUHOWMLC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |