C9H17NO — CID 117228568
2-cyclobutyl-4,4-dimethyl-1,3-oxazolidine (PubChem CID 117228568) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 2-cyclobutyl-4,4-dimethyl-1,3-oxazolidine.
| Compound Name | 2-cyclobutyl-4,4-dimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 117228568 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 2-cyclobutyl-4,4-dimethyl-1,3-oxazolidine |
| SMILES | CC1(C)COC(C2CCC2)N1 |
| InChI | InChI=1S/C9H17NO/c1-9(2)6-11-8(10-9)7-4-3-5-7/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | WCUPGHNENYFVFR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |