C12H24ClNO — CID 117227188
2-cyclohexyl-5,5-dimethyl-1,3-oxazinane;hydrochloride (PubChem CID 117227188) has the molecular formula C12H24ClNO and a molecular weight of 233.78 g/mol. Its IUPAC name is 2-cyclohexyl-5,5-dimethyl-1,3-oxazinane;hydrochloride.
| Compound Name | 2-cyclohexyl-5,5-dimethyl-1,3-oxazinane;hydrochloride |
|---|---|
| PubChem CID | 117227188 |
| Molecular Formula | C12H24ClNO |
| Molecular Weight | 233.78 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-cyclohexyl-5,5-dimethyl-1,3-oxazinane;hydrochloride |
| SMILES | CC1(C)CNC(C2CCCCC2)OC1.Cl |
| InChI | InChI=1S/C12H23NO.ClH/c1-12(2)8-13-11(14-9-12)10-6-4-3-5-7-10;/h10-11,13H,3-9H2,1-2H3;1H |
| InChIKey | XKTNEDUXUNXSRT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |