C11H22ClNO — CID 117227184
2-cyclohexyl-5-methyl-1,3-oxazinane;hydrochloride (PubChem CID 117227184) has the molecular formula C11H22ClNO and a molecular weight of 219.76 g/mol. Its IUPAC name is 2-cyclohexyl-5-methyl-1,3-oxazinane;hydrochloride.
| Compound Name | 2-cyclohexyl-5-methyl-1,3-oxazinane;hydrochloride |
|---|---|
| PubChem CID | 117227184 |
| Molecular Formula | C11H22ClNO |
| Molecular Weight | 219.76 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-cyclohexyl-5-methyl-1,3-oxazinane;hydrochloride |
| SMILES | CC1CNC(C2CCCCC2)OC1.Cl |
| InChI | InChI=1S/C11H21NO.ClH/c1-9-7-12-11(13-8-9)10-5-3-2-4-6-10;/h9-12H,2-8H2,1H3;1H |
| InChIKey | UHLKBJDWKQYUFX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |