C6H14ClNO — CID 117226965
2,5-dimethyl-1,3-oxazinane;hydrochloride (PubChem CID 117226965) has the molecular formula C6H14ClNO and a molecular weight of 151.64 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-oxazinane;hydrochloride.
| Compound Name | 2,5-dimethyl-1,3-oxazinane;hydrochloride |
|---|---|
| PubChem CID | 117226965 |
| Molecular Formula | C6H14ClNO |
| Molecular Weight | 151.64 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 2,5-dimethyl-1,3-oxazinane;hydrochloride |
| SMILES | CC1CNC(C)OC1.Cl |
| InChI | InChI=1S/C6H13NO.ClH/c1-5-3-7-6(2)8-4-5;/h5-7H,3-4H2,1-2H3;1H |
| InChIKey | WBHKFNJNRQLURZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.64 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |