C5H11NO2 — CID 154516283
5-methyl-1,3-dioxan-2-amine (PubChem CID 154516283) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is 5-methyl-1,3-dioxan-2-amine.
| Compound Name | 5-methyl-1,3-dioxan-2-amine |
|---|---|
| PubChem CID | 154516283 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 5-methyl-1,3-dioxan-2-amine |
| SMILES | CC1COC(N)OC1 |
| InChI | InChI=1S/C5H11NO2/c1-4-2-7-5(6)8-3-4/h4-5H,2-3,6H2,1H3 |
| InChIKey | QDBLMQXRWIQJFK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |