C6H14AlNO — CID 148890995
(2R,3S)-2-alumanyl-5-methyloxan-3-amine (PubChem CID 148890995) has the molecular formula C6H14AlNO and a molecular weight of 143.17 g/mol. Its IUPAC name is (2R,3S)-2-alumanyl-5-methyloxan-3-amine.
| Compound Name | (2R,3S)-2-alumanyl-5-methyloxan-3-amine |
|---|---|
| PubChem CID | 148890995 |
| Molecular Formula | C6H14AlNO |
| Molecular Weight | 143.17 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (2R,3S)-2-alumanyl-5-methyloxan-3-amine |
| SMILES | CC1CO[C@H]([AlH2])[C@@H](N)C1 |
| InChI | InChI=1S/C6H12NO.Al.2H/c1-5-2-6(7)4-8-3-5;;;/h4-6H,2-3,7H2,1H3;;;/t5?,6-;;;/m0.../s1 |
| InChIKey | PEXPXTIKHASWFI-SPWZSHALSA-N |
| XLogP | -0.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.17 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |