About 2-alumanyl-N,5-dimethyloxan-3-amine
2-alumanyl-N,5-dimethyloxan-3-amine (PubChem CID 163592102) has the molecular formula C7H16AlNO
and a molecular weight of 157.19 g/mol. Its IUPAC name is 2-alumanyl-N,5-dimethyloxan-3-amine.
Molecular Properties
| Compound Name | 2-alumanyl-N,5-dimethyloxan-3-amine |
| PubChem CID | 163592102 |
| Molecular Formula | C7H16AlNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | 2-alumanyl-N,5-dimethyloxan-3-amine |
| SMILES | CNC1CC(C)COC1[AlH2] |
| InChI | InChI=1S/C7H14NO.Al.2H/c1-6-3-7(8-2)5-9-4-6;;;/h5-8H,3-4H2,1-2H3;;; |
| InChIKey | GQJBXKMKMAOISE-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-alumanyl-N,5-dimethyloxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-alumanyl-N,5-dimethyloxan-3-amine?
The IUPAC name of 2-alumanyl-N,5-dimethyloxan-3-amine (CID 163592102) is 2-alumanyl-N,5-dimethyloxan-3-amine.
What is the SMILES notation for 2-alumanyl-N,5-dimethyloxan-3-amine?
The canonical SMILES for 2-alumanyl-N,5-dimethyloxan-3-amine is CNC1CC(C)COC1[AlH2].
What is the InChIKey of 2-alumanyl-N,5-dimethyloxan-3-amine?
The InChIKey is GQJBXKMKMAOISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14NO.Al.2H/c1-6-3-7(8-2)5-9-4-6;;;/h5-8H,3-4H2,1-2H3;;;.
What are the key properties of 2-alumanyl-N,5-dimethyloxan-3-amine?
2-alumanyl-N,5-dimethyloxan-3-amine has a molecular weight of 157.19 g/mol, XLogP of -0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-alumanyl-N,5-dimethyloxan-3-amine is sourced from PubChem (CID 163592102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).