C7H15NO — CID 20600657
2,5-dimethyloxan-3-amine (PubChem CID 20600657) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is 2,5-dimethyloxan-3-amine.
| Compound Name | 2,5-dimethyloxan-3-amine |
|---|---|
| PubChem CID | 20600657 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 2,5-dimethyloxan-3-amine |
| SMILES | CC1COC(C)C(N)C1 |
| InChI | InChI=1S/C7H15NO/c1-5-3-7(8)6(2)9-4-5/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | ARTKFXDMOICTDV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |