C9H18N2 — CID 163883093
N,4,7-trimethyl-7-azabicyclo[4.1.0]heptan-2-amine (PubChem CID 163883093) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is N,4,7-trimethyl-7-azabicyclo[4.1.0]heptan-2-amine.
| Compound Name | N,4,7-trimethyl-7-azabicyclo[4.1.0]heptan-2-amine |
|---|---|
| PubChem CID | 163883093 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N,4,7-trimethyl-7-azabicyclo[4.1.0]heptan-2-amine |
| SMILES | CNC1CC(C)CC2C1N2C |
| InChI | InChI=1S/C9H18N2/c1-6-4-7(10-2)9-8(5-6)11(9)3/h6-10H,4-5H2,1-3H3 |
| InChIKey | PUZCVVCAWVEWOZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|