C9H20N2 — CID 59421618
N,1,2,6-tetramethylpiperidin-4-amine (PubChem CID 59421618) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is N,1,2,6-tetramethylpiperidin-4-amine.
| Compound Name | N,1,2,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 59421618 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | N,1,2,6-tetramethylpiperidin-4-amine |
| SMILES | CNC1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C9H20N2/c1-7-5-9(10-3)6-8(2)11(7)4/h7-10H,5-6H2,1-4H3 |
| InChIKey | NDSBUTJMIZATII-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |