C10H24N2 — CID 178011529
ethane;N,1,2-trimethylpiperidin-4-amine (PubChem CID 178011529) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is ethane;N,1,2-trimethylpiperidin-4-amine.
| Compound Name | ethane;N,1,2-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 178011529 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | ethane;N,1,2-trimethylpiperidin-4-amine |
| SMILES | CC.CNC1CCN(C)C(C)C1 |
| InChI | InChI=1S/C8H18N2.C2H6/c1-7-6-8(9-2)4-5-10(7)3;1-2/h7-9H,4-6H2,1-3H3;1-2H3 |
| InChIKey | ZZMMOTXRIOSNTR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |