C7H18ClN3 — CID 170897700
[(2S,4S)-1,2-dimethylpiperidin-4-yl]hydrazine;hydrochloride (PubChem CID 170897700) has the molecular formula C7H18ClN3 and a molecular weight of 179.69 g/mol. Its IUPAC name is [(2S,4S)-1,2-dimethylpiperidin-4-yl]hydrazine;hydrochloride.
| Compound Name | [(2S,4S)-1,2-dimethylpiperidin-4-yl]hydrazine;hydrochloride |
|---|---|
| PubChem CID | 170897700 |
| Molecular Formula | C7H18ClN3 |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | [(2S,4S)-1,2-dimethylpiperidin-4-yl]hydrazine;hydrochloride |
| SMILES | C[C@H]1C[C@@H](NN)CCN1C.Cl |
| InChI | InChI=1S/C7H17N3.ClH/c1-6-5-7(9-8)3-4-10(6)2;/h6-7,9H,3-5,8H2,1-2H3;1H/t6-,7-;/m0./s1 |
| InChIKey | UVEANGWDAXJHQB-LEUCUCNGSA-N |
| XLogP | 0.35 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|