C7H17N3 — CID 55281806
(1,2-dimethylpiperidin-4-yl)hydrazine (PubChem CID 55281806) has the molecular formula C7H17N3 and a molecular weight of 143.23 g/mol. Its IUPAC name is (1,2-dimethylpiperidin-4-yl)hydrazine.
| Compound Name | (1,2-dimethylpiperidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 55281806 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | (1,2-dimethylpiperidin-4-yl)hydrazine |
| SMILES | CC1CC(NN)CCN1C |
| InChI | InChI=1S/C7H17N3/c1-6-5-7(9-8)3-4-10(6)2/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | XXLVYOLFKKIDAN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|