About 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine
2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine (PubChem CID 83005430) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine |
| PubChem CID | 83005430 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine |
| SMILES | CC1CC(NN(C)C)CCN1C |
| InChI | InChI=1S/C9H21N3/c1-8-7-9(10-11(2)3)5-6-12(8)4/h8-10H,5-7H2,1-4H3 |
| InChIKey | RXDAEDPYZBXHGO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine?
The IUPAC name of 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine (CID 83005430) is 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine.
What is the SMILES notation for 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine?
The canonical SMILES for 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine is CC1CC(NN(C)C)CCN1C.
What is the InChIKey of 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine?
The InChIKey is RXDAEDPYZBXHGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3/c1-8-7-9(10-11(2)3)5-6-12(8)4/h8-10H,5-7H2,1-4H3.
What are the key properties of 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine?
2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine has a molecular weight of 171.29 g/mol, XLogP of 0.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dimethylpiperidin-4-yl)-1,1-dimethylhydrazine is sourced from PubChem (CID 83005430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).