C12H26N2O — CID 163258783
2-methylpropanal;N,1,2-trimethylpiperidin-4-amine (PubChem CID 163258783) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-methylpropanal;N,1,2-trimethylpiperidin-4-amine.
| Compound Name | 2-methylpropanal;N,1,2-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 163258783 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 2-methylpropanal;N,1,2-trimethylpiperidin-4-amine |
| SMILES | CC(C)C=O.CNC1CCN(C)C(C)C1 |
| InChI | InChI=1S/C8H18N2.C4H8O/c1-7-6-8(9-2)4-5-10(7)3;1-4(2)3-5/h7-9H,4-6H2,1-3H3;3-4H,1-2H3 |
| InChIKey | NCLKZFMARIJFNE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|