C9H20N2 — CID 22088644
1,2,5,7-tetramethyl-1,4-diazepane (PubChem CID 22088644) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 1,2,5,7-tetramethyl-1,4-diazepane.
| Compound Name | 1,2,5,7-tetramethyl-1,4-diazepane |
|---|---|
| PubChem CID | 22088644 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1,2,5,7-tetramethyl-1,4-diazepane |
| SMILES | CC1CC(C)N(C)C(C)CN1 |
| InChI | InChI=1S/C9H20N2/c1-7-5-8(2)11(4)9(3)6-10-7/h7-10H,5-6H2,1-4H3 |
| InChIKey | WJNGMWHCZJNWFB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |