C8H19N3 — CID 19767343
2-(2,5-dimethylpiperazin-1-yl)ethanamine (PubChem CID 19767343) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is 2-(2,5-dimethylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(2,5-dimethylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 19767343 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 2-(2,5-dimethylpiperazin-1-yl)ethanamine |
| SMILES | CC1CN(CCN)C(C)CN1 |
| InChI | InChI=1S/C8H19N3/c1-7-6-11(4-3-9)8(2)5-10-7/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | MBWAUPPOQKPRNN-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |