About 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole
4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole (PubChem CID 106043580) has the molecular formula C12H21N3S
and a molecular weight of 239.39 g/mol. Its IUPAC name is 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole |
| PubChem CID | 106043580 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(CCN2CC(C)NCC2C)cs1 |
| InChI | InChI=1S/C12H21N3S/c1-9-7-15(10(2)6-13-9)5-4-12-8-16-11(3)14-12/h8-10,13H,4-7H2,1-3H3 |
| InChIKey | VTOUDGGWYDPOAZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole?
The IUPAC name of 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole (CID 106043580) is 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole.
What is the SMILES notation for 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole?
The canonical SMILES for 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole is Cc1nc(CCN2CC(C)NCC2C)cs1.
What is the InChIKey of 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole?
The InChIKey is VTOUDGGWYDPOAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3S/c1-9-7-15(10(2)6-13-9)5-4-12-8-16-11(3)14-12/h8-10,13H,4-7H2,1-3H3.
What are the key properties of 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole?
4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole has a molecular weight of 239.39 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,5-dimethylpiperazin-1-yl)ethyl]-2-methyl-1,3-thiazole is sourced from PubChem (CID 106043580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).