C9H18N2 — CID 91251130
(5S)-2,5-dimethyl-1-prop-2-enylpiperazine (PubChem CID 91251130) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (5S)-2,5-dimethyl-1-prop-2-enylpiperazine.
| Compound Name | (5S)-2,5-dimethyl-1-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 91251130 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (5S)-2,5-dimethyl-1-prop-2-enylpiperazine |
| SMILES | C=CCN1C[C@H](C)NCC1C |
| InChI | InChI=1S/C9H18N2/c1-4-5-11-7-8(2)10-6-9(11)3/h4,8-10H,1,5-7H2,2-3H3/t8-,9?/m0/s1 |
| InChIKey | VKUXNUOPPQWDMV-IENPIDJESA-N |
| XLogP | 0.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|