C12H26N2O2 — CID 81093833
1-(2,2-diethoxyethyl)-2,5-dimethylpiperazine (PubChem CID 81093833) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-2,5-dimethylpiperazine.
| Compound Name | 1-(2,2-diethoxyethyl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 81093833 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-2,5-dimethylpiperazine |
| SMILES | CCOC(CN1CC(C)NCC1C)OCC |
| InChI | InChI=1S/C12H26N2O2/c1-5-15-12(16-6-2)9-14-8-10(3)13-7-11(14)4/h10-13H,5-9H2,1-4H3 |
| InChIKey | GFTUXPLTFZPFRU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|