About 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide
4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide (PubChem CID 64980389) has the molecular formula C14H29N3O
and a molecular weight of 255.41 g/mol. Its IUPAC name is 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide.
Molecular Properties
| Compound Name | 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide |
| PubChem CID | 64980389 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)CCCN1CC(C)NCC1C |
| InChI | InChI=1S/C14H29N3O/c1-5-16(6-2)14(18)8-7-9-17-11-12(3)15-10-13(17)4/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | UXYLCCIICIECEB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide?
The IUPAC name of 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide (CID 64980389) is 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide.
What is the SMILES notation for 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide?
The canonical SMILES for 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide is CCN(CC)C(=O)CCCN1CC(C)NCC1C.
What is the InChIKey of 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide?
The InChIKey is UXYLCCIICIECEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3O/c1-5-16(6-2)14(18)8-7-9-17-11-12(3)15-10-13(17)4/h12-13,15H,5-11H2,1-4H3.
What are the key properties of 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide?
4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide has a molecular weight of 255.41 g/mol, XLogP of 1.32, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethylpiperazin-1-yl)-N,N-diethylbutanamide is sourced from PubChem (CID 64980389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).