C11H24N2O2S — CID 65098411
1-(3-ethylsulfonylpropyl)-2,5-dimethylpiperazine (PubChem CID 65098411) has the molecular formula C11H24N2O2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-(3-ethylsulfonylpropyl)-2,5-dimethylpiperazine.
| Compound Name | 1-(3-ethylsulfonylpropyl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 65098411 |
| Molecular Formula | C11H24N2O2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1-(3-ethylsulfonylpropyl)-2,5-dimethylpiperazine |
| SMILES | CCS(=O)(=O)CCCN1CC(C)NCC1C |
| InChI | InChI=1S/C11H24N2O2S/c1-4-16(14,15)7-5-6-13-9-10(2)12-8-11(13)3/h10-12H,4-9H2,1-3H3 |
| InChIKey | YIUIMOMSKWOFGI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |