C11H24N2O — CID 64938351
1-(1-ethoxypropan-2-yl)-2,5-dimethylpiperazine (PubChem CID 64938351) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-(1-ethoxypropan-2-yl)-2,5-dimethylpiperazine.
| Compound Name | 1-(1-ethoxypropan-2-yl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 64938351 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1-(1-ethoxypropan-2-yl)-2,5-dimethylpiperazine |
| SMILES | CCOCC(C)N1CC(C)NCC1C |
| InChI | InChI=1S/C11H24N2O/c1-5-14-8-11(4)13-7-9(2)12-6-10(13)3/h9-12H,5-8H2,1-4H3 |
| InChIKey | HVGFTPNQTRWJKX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |