C10H20N2 — CID 64980427
1-but-3-en-2-yl-2,5-dimethylpiperazine (PubChem CID 64980427) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-but-3-en-2-yl-2,5-dimethylpiperazine.
| Compound Name | 1-but-3-en-2-yl-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 64980427 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-but-3-en-2-yl-2,5-dimethylpiperazine |
| SMILES | C=CC(C)N1CC(C)NCC1C |
| InChI | InChI=1S/C10H20N2/c1-5-9(3)12-7-8(2)11-6-10(12)4/h5,8-11H,1,6-7H2,2-4H3 |
| InChIKey | OWVQCVVZTPODQB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|