C13H28N2O — CID 64979655
1-(4-methoxy-4-methylpentan-2-yl)-2,5-dimethylpiperazine (PubChem CID 64979655) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-(4-methoxy-4-methylpentan-2-yl)-2,5-dimethylpiperazine.
| Compound Name | 1-(4-methoxy-4-methylpentan-2-yl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 64979655 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 1-(4-methoxy-4-methylpentan-2-yl)-2,5-dimethylpiperazine |
| SMILES | COC(C)(C)CC(C)N1CC(C)NCC1C |
| InChI | InChI=1S/C13H28N2O/c1-10-9-15(12(3)8-14-10)11(2)7-13(4,5)16-6/h10-12,14H,7-9H2,1-6H3 |
| InChIKey | QCRBQICLAQHNDY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |