C6H13NS — CID 94843330
(2R,4S)-2-methylpiperidine-4-thiol (PubChem CID 94843330) has the molecular formula C6H13NS and a molecular weight of 131.24 g/mol. Its IUPAC name is (2R,4S)-2-methylpiperidine-4-thiol.
| Compound Name | (2R,4S)-2-methylpiperidine-4-thiol |
|---|---|
| PubChem CID | 94843330 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | (2R,4S)-2-methylpiperidine-4-thiol |
| SMILES | C[C@@H]1C[C@@H](S)CCN1 |
| InChI | InChI=1S/C6H13NS/c1-5-4-6(8)2-3-7-5/h5-8H,2-4H2,1H3/t5-,6+/m1/s1 |
| InChIKey | MKRVFBSJMPWKOC-RITPCOANSA-N |
| XLogP | 1.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|