C7H16N2 — CID 129409873
[(2R,4S)-2-methylpiperidin-4-yl]methanamine (PubChem CID 129409873) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is [(2R,4S)-2-methylpiperidin-4-yl]methanamine.
| Compound Name | [(2R,4S)-2-methylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 129409873 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | [(2R,4S)-2-methylpiperidin-4-yl]methanamine |
| SMILES | C[C@@H]1C[C@@H](CN)CCN1 |
| InChI | InChI=1S/C7H16N2/c1-6-4-7(5-8)2-3-9-6/h6-7,9H,2-5,8H2,1H3/t6-,7+/m1/s1 |
| InChIKey | KAYRFWPPZRXSPK-RQJHMYQMSA-N |
| XLogP | 0.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |