C7H15N — CID 144551274
(4R)-2,4-dimethylpiperidine (PubChem CID 144551274) has the molecular formula C7H15N and a molecular weight of 113.20 g/mol. Its IUPAC name is (4R)-2,4-dimethylpiperidine.
| Compound Name | (4R)-2,4-dimethylpiperidine |
|---|---|
| PubChem CID | 144551274 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | (4R)-2,4-dimethylpiperidine |
| SMILES | CC1C[C@H](C)CCN1 |
| InChI | InChI=1S/C7H15N/c1-6-3-4-8-7(2)5-6/h6-8H,3-5H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | QOZOFODNIBQPGN-ULUSZKPHSA-N |
| XLogP | 1.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |