About (4R)-2,4-dimethylpiperidine
(4R)-2,4-dimethylpiperidine (PubChem CID 144551274) has the molecular formula C7H15N
and a molecular weight of 113.20 g/mol. Its IUPAC name is (4R)-2,4-dimethylpiperidine.
Molecular Properties
| Compound Name | (4R)-2,4-dimethylpiperidine |
| PubChem CID | 144551274 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | (4R)-2,4-dimethylpiperidine |
| SMILES | CC1C[C@H](C)CCN1 |
| InChI | InChI=1S/C7H15N/c1-6-3-4-8-7(2)5-6/h6-8H,3-5H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | QOZOFODNIBQPGN-ULUSZKPHSA-N |
| XLogP | 1.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-2,4-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,4-dimethylpiperidine?
The IUPAC name of (4R)-2,4-dimethylpiperidine (CID 144551274) is (4R)-2,4-dimethylpiperidine.
What is the SMILES notation for (4R)-2,4-dimethylpiperidine?
The canonical SMILES for (4R)-2,4-dimethylpiperidine is CC1C[C@H](C)CCN1.
What is the InChIKey of (4R)-2,4-dimethylpiperidine?
The InChIKey is QOZOFODNIBQPGN-ULUSZKPHSA-N. The full InChI is InChI=1S/C7H15N/c1-6-3-4-8-7(2)5-6/h6-8H,3-5H2,1-2H3/t6-,7?/m1/s1.
What are the key properties of (4R)-2,4-dimethylpiperidine?
(4R)-2,4-dimethylpiperidine has a molecular weight of 113.20 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,4-dimethylpiperidine is sourced from PubChem (CID 144551274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).