C13H31N — CID 164865353
ethane;1,2,4,6-tetramethylpiperidine (PubChem CID 164865353) has the molecular formula C13H31N and a molecular weight of 201.40 g/mol. Its IUPAC name is ethane;1,2,4,6-tetramethylpiperidine.
| Compound Name | ethane;1,2,4,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 164865353 |
| Molecular Formula | C13H31N |
| Molecular Weight | 201.40 g/mol |
| Exact Mass | 201.25 |
| IUPAC Name | ethane;1,2,4,6-tetramethylpiperidine |
| SMILES | CC.CC.CC1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C9H19N.2C2H6/c1-7-5-8(2)10(4)9(3)6-7;2*1-2/h7-9H,5-6H2,1-4H3;2*1-2H3 |
| InChIKey | XJPWFOHGALPUAX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |