C11H25NS — CID 177053613
ethane;ethanethial;1,2,4-trimethylpyrrolidine (PubChem CID 177053613) has the molecular formula C11H25NS and a molecular weight of 203.39 g/mol. Its IUPAC name is ethane;ethanethial;1,2,4-trimethylpyrrolidine.
| Compound Name | ethane;ethanethial;1,2,4-trimethylpyrrolidine |
|---|---|
| PubChem CID | 177053613 |
| Molecular Formula | C11H25NS |
| Molecular Weight | 203.39 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | ethane;ethanethial;1,2,4-trimethylpyrrolidine |
| SMILES | CC.CC1CC(C)N(C)C1.CC=S |
| InChI | InChI=1S/C7H15N.C2H4S.C2H6/c1-6-4-7(2)8(3)5-6;1-2-3;1-2/h6-7H,4-5H2,1-3H3;2H,1H3;1-2H3 |
| InChIKey | FBAULOQNWJRIJZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|