C11H25N — CID 145040358
ethane;(2R,5R)-1,2,4,5-tetramethylpiperidine (PubChem CID 145040358) has the molecular formula C11H25N and a molecular weight of 171.33 g/mol. Its IUPAC name is ethane;(2R,5R)-1,2,4,5-tetramethylpiperidine.
| Compound Name | ethane;(2R,5R)-1,2,4,5-tetramethylpiperidine |
|---|---|
| PubChem CID | 145040358 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | ethane;(2R,5R)-1,2,4,5-tetramethylpiperidine |
| SMILES | CC.CC1C[C@@H](C)N(C)C[C@@H]1C |
| InChI | InChI=1S/C9H19N.C2H6/c1-7-5-9(3)10(4)6-8(7)2;1-2/h7-9H,5-6H2,1-4H3;1-2H3/t7?,8-,9+;/m0./s1 |
| InChIKey | UXBYTPJIOOOGKF-ZKKFVHNYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |