C8H16ClN — CID 71367708
4-chloro-1,2,5-trimethylpiperidine (PubChem CID 71367708) has the molecular formula C8H16ClN and a molecular weight of 161.68 g/mol. Its IUPAC name is 4-chloro-1,2,5-trimethylpiperidine.
| Compound Name | 4-chloro-1,2,5-trimethylpiperidine |
|---|---|
| PubChem CID | 71367708 |
| Molecular Formula | C8H16ClN |
| Molecular Weight | 161.68 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 4-chloro-1,2,5-trimethylpiperidine |
| SMILES | CC1CN(C)C(C)CC1Cl |
| InChI | InChI=1S/C8H16ClN/c1-6-5-10(3)7(2)4-8(6)9/h6-8H,4-5H2,1-3H3 |
| InChIKey | GZMOKERKQZDDEH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.68 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|