C8H18N2 — CID 98195230
(2S,4S,5S)-1,2,5-trimethylpiperidin-4-amine (PubChem CID 98195230) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is (2S,4S,5S)-1,2,5-trimethylpiperidin-4-amine.
| Compound Name | (2S,4S,5S)-1,2,5-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 98195230 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | (2S,4S,5S)-1,2,5-trimethylpiperidin-4-amine |
| SMILES | C[C@H]1CN(C)[C@@H](C)C[C@@H]1N |
| InChI | InChI=1S/C8H18N2/c1-6-5-10(3)7(2)4-8(6)9/h6-8H,4-5,9H2,1-3H3/t6-,7-,8-/m0/s1 |
| InChIKey | QDZDLPPKTNOOAE-FXQIFTODSA-N |
| XLogP | 0.67 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |