C7H17N3 — CID 82417846
1,6-dimethylpiperidine-3,4-diamine (PubChem CID 82417846) has the molecular formula C7H17N3 and a molecular weight of 143.23 g/mol. Its IUPAC name is 1,6-dimethylpiperidine-3,4-diamine.
| Compound Name | 1,6-dimethylpiperidine-3,4-diamine |
|---|---|
| PubChem CID | 82417846 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | 1,6-dimethylpiperidine-3,4-diamine |
| SMILES | CC1CC(N)C(N)CN1C |
| InChI | InChI=1S/C7H17N3/c1-5-3-6(8)7(9)4-10(5)2/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | UFCCAENDUGKAOR-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |