C9H19N — CID 142849409
1,2-dimethyl-4-propan-2-ylpyrrolidine (PubChem CID 142849409) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is 1,2-dimethyl-4-propan-2-ylpyrrolidine.
| Compound Name | 1,2-dimethyl-4-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 142849409 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 1,2-dimethyl-4-propan-2-ylpyrrolidine |
| SMILES | CC(C)C1CC(C)N(C)C1 |
| InChI | InChI=1S/C9H19N/c1-7(2)9-5-8(3)10(4)6-9/h7-9H,5-6H2,1-4H3 |
| InChIKey | ZWGZYHSKQSUTBI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |