About (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine
(2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine (PubChem CID 155468867) has the molecular formula C15H31N
and a molecular weight of 225.42 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine |
| PubChem CID | 155468867 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine |
| SMILES | CC(C)CCN1[C@H](C)CC(C(C)C)C[C@H]1C |
| InChI | InChI=1S/C15H31N/c1-11(2)7-8-16-13(5)9-15(12(3)4)10-14(16)6/h11-15H,7-10H2,1-6H3/t13-,14-/m1/s1 |
| InChIKey | RVFLTFBGPZPVOH-ZIAGYGMSSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine?
The IUPAC name of (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine (CID 155468867) is (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine.
What is the SMILES notation for (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine?
The canonical SMILES for (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine is CC(C)CCN1[C@H](C)CC(C(C)C)C[C@H]1C.
What is the InChIKey of (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine?
The InChIKey is RVFLTFBGPZPVOH-ZIAGYGMSSA-N. The full InChI is InChI=1S/C15H31N/c1-11(2)7-8-16-13(5)9-15(12(3)4)10-14(16)6/h11-15H,7-10H2,1-6H3/t13-,14-/m1/s1.
What are the key properties of (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine?
(2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine has a molecular weight of 225.42 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6R)-2,6-dimethyl-1-(3-methylbutyl)-4-propan-2-ylpiperidine is sourced from PubChem (CID 155468867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).