C10H20FN — CID 130702975
1-(3-fluorobutyl)-2,5-dimethylpyrrolidine (PubChem CID 130702975) has the molecular formula C10H20FN and a molecular weight of 173.28 g/mol. Its IUPAC name is 1-(3-fluorobutyl)-2,5-dimethylpyrrolidine.
| Compound Name | 1-(3-fluorobutyl)-2,5-dimethylpyrrolidine |
|---|---|
| PubChem CID | 130702975 |
| Molecular Formula | C10H20FN |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | 1-(3-fluorobutyl)-2,5-dimethylpyrrolidine |
| SMILES | CC(F)CCN1C(C)CCC1C |
| InChI | InChI=1S/C10H20FN/c1-8(11)6-7-12-9(2)4-5-10(12)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | VPJUSBOEYICWLV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |