C9H19N — CID 130453016
2,3-dimethyl-1-(3-methylbutyl)aziridine (PubChem CID 130453016) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is 2,3-dimethyl-1-(3-methylbutyl)aziridine.
| Compound Name | 2,3-dimethyl-1-(3-methylbutyl)aziridine |
|---|---|
| PubChem CID | 130453016 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 2,3-dimethyl-1-(3-methylbutyl)aziridine |
| SMILES | CC(C)CCN1C(C)C1C |
| InChI | InChI=1S/C9H19N/c1-7(2)5-6-10-8(3)9(10)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | CGFQYMHNPMZQNB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|