C5H11N — CID 154470039
(2R)-1,2,3-trimethylaziridine (PubChem CID 154470039) has the molecular formula C5H11N and a molecular weight of 85.15 g/mol. Its IUPAC name is (2R)-1,2,3-trimethylaziridine.
| Compound Name | (2R)-1,2,3-trimethylaziridine |
|---|---|
| PubChem CID | 154470039 |
| Molecular Formula | C5H11N |
| Molecular Weight | 85.15 g/mol |
| Exact Mass | 85.09 |
| IUPAC Name | (2R)-1,2,3-trimethylaziridine |
| SMILES | CC1[C@@H](C)N1C |
| InChI | InChI=1S/C5H11N/c1-4-5(2)6(4)3/h4-5H,1-3H3/t4-,5?,6?/m1/s1 |
| InChIKey | FACHDUAMWHEPML-IISSFJTQSA-N |
| XLogP | 0.71 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 85.15 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|