C11H24N2 — CID 93258428
(2R,4R,5R)-1,2,5-trimethyl-N-propan-2-ylpiperidin-4-amine (PubChem CID 93258428) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is (2R,4R,5R)-1,2,5-trimethyl-N-propan-2-ylpiperidin-4-amine.
| Compound Name | (2R,4R,5R)-1,2,5-trimethyl-N-propan-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 93258428 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | (2R,4R,5R)-1,2,5-trimethyl-N-propan-2-ylpiperidin-4-amine |
| SMILES | CC(C)N[C@@H]1C[C@@H](C)N(C)C[C@H]1C |
| InChI | InChI=1S/C11H24N2/c1-8(2)12-11-6-10(4)13(5)7-9(11)3/h8-12H,6-7H2,1-5H3/t9-,10-,11-/m1/s1 |
| InChIKey | LDYUEKKZBOXMCU-GMTAPVOTSA-N |
| XLogP | 1.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |