C16H34N2 — CID 113262513
1,2,5-trimethyl-N-octan-4-ylpiperidin-4-amine (PubChem CID 113262513) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is 1,2,5-trimethyl-N-octan-4-ylpiperidin-4-amine.
| Compound Name | 1,2,5-trimethyl-N-octan-4-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 113262513 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | 1,2,5-trimethyl-N-octan-4-ylpiperidin-4-amine |
| SMILES | CCCCC(CCC)NC1CC(C)N(C)CC1C |
| InChI | InChI=1S/C16H34N2/c1-6-8-10-15(9-7-2)17-16-11-14(4)18(5)12-13(16)3/h13-17H,6-12H2,1-5H3 |
| InChIKey | JHAOPOXJHFTXFE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |