C13H28N2 — CID 93258445
(2R,4S,5S)-1,2,5-trimethyl-N-pentylpiperidin-4-amine (PubChem CID 93258445) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is (2R,4S,5S)-1,2,5-trimethyl-N-pentylpiperidin-4-amine.
| Compound Name | (2R,4S,5S)-1,2,5-trimethyl-N-pentylpiperidin-4-amine |
|---|---|
| PubChem CID | 93258445 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | (2R,4S,5S)-1,2,5-trimethyl-N-pentylpiperidin-4-amine |
| SMILES | CCCCCN[C@H]1C[C@@H](C)N(C)C[C@@H]1C |
| InChI | InChI=1S/C13H28N2/c1-5-6-7-8-14-13-9-12(3)15(4)10-11(13)2/h11-14H,5-10H2,1-4H3/t11-,12+,13-/m0/s1 |
| InChIKey | YUXAOOKQNMXUKB-XQQFMLRXSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|