C16H34N4 — CID 43665481
1,2,5-trimethyl-N-[3-(4-methylpiperazin-1-yl)propyl]piperidin-4-amine (PubChem CID 43665481) has the molecular formula C16H34N4 and a molecular weight of 282.48 g/mol. Its IUPAC name is 1,2,5-trimethyl-N-[3-(4-methylpiperazin-1-yl)propyl]piperidin-4-amine.
| Compound Name | 1,2,5-trimethyl-N-[3-(4-methylpiperazin-1-yl)propyl]piperidin-4-amine |
|---|---|
| PubChem CID | 43665481 |
| Molecular Formula | C16H34N4 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.28 |
| IUPAC Name | 1,2,5-trimethyl-N-[3-(4-methylpiperazin-1-yl)propyl]piperidin-4-amine |
| SMILES | CC1CN(C)C(C)CC1NCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C16H34N4/c1-14-13-19(4)15(2)12-16(14)17-6-5-7-20-10-8-18(3)9-11-20/h14-17H,5-13H2,1-4H3 |
| InChIKey | NVPMVDBEORAFAE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|