C11H25N3 — CID 60890113
N'-(1,2,5-trimethylpiperidin-4-yl)propane-1,3-diamine (PubChem CID 60890113) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is N'-(1,2,5-trimethylpiperidin-4-yl)propane-1,3-diamine.
| Compound Name | N'-(1,2,5-trimethylpiperidin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 60890113 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | N'-(1,2,5-trimethylpiperidin-4-yl)propane-1,3-diamine |
| SMILES | CC1CN(C)C(C)CC1NCCCN |
| InChI | InChI=1S/C11H25N3/c1-9-8-14(3)10(2)7-11(9)13-6-4-5-12/h9-11,13H,4-8,12H2,1-3H3 |
| InChIKey | FKMFFKXQZNZOLX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|